Spaces:
Running
Running
| import gradio as gr | |
| from huggingface_hub import InferenceClient | |
| import matplotlib.pyplot as plt | |
| from PIL import Image | |
| from rdkit.Chem import Descriptors, QED, Draw | |
| from rdkit.Chem.Crippen import MolLogP | |
| import pandas as pd | |
| from rdkit.Contrib.SA_Score import sascorer | |
| from rdkit.Chem import DataStructs, AllChem | |
| from transformers import BartForConditionalGeneration, AutoTokenizer, AutoModel | |
| from transformers.modeling_outputs import BaseModelOutput | |
| import selfies as sf | |
| from rdkit import Chem | |
| import torch | |
| import numpy as np | |
| import umap | |
| import pickle | |
| import xgboost as xgb | |
| from sklearn.svm import SVR | |
| from sklearn.linear_model import LinearRegression | |
| from sklearn.kernel_ridge import KernelRidge | |
| import json | |
| import os | |
| os.environ["OMP_MAX_ACTIVE_LEVELS"] = "1" | |
| # my_theme = gr.Theme.from_hub("ysharma/steampunk") | |
| # my_theme = gr.themes.Glass() | |
| """ | |
| # カスタムテーマ設定 | |
| theme = gr.themes.Default().set( | |
| body_background_fill="#000000", # 背景色を黒に設定 | |
| text_color="#FFFFFF", # テキスト色を白に設定 | |
| ) | |
| """ | |
| """ | |
| import sys | |
| sys.path.append("models") | |
| sys.path.append("../models") | |
| sys.path.append("../")""" | |
| # Get the current file's directory | |
| base_dir = os.path.dirname(__file__) | |
| print("Base Dir : ", base_dir) | |
| import models.fm4m as fm4m | |
| # Function to display molecule image from SMILES | |
| def smiles_to_image(smiles): | |
| mol = Chem.MolFromSmiles(smiles) | |
| if mol: | |
| img = Draw.MolToImage(mol) | |
| return img | |
| return None | |
| # Function to get canonical SMILES | |
| def get_canonical_smiles(smiles): | |
| mol = Chem.MolFromSmiles(smiles) | |
| if mol: | |
| return Chem.MolToSmiles(mol, canonical=True) | |
| return None | |
| # Dictionary for SMILES strings and corresponding images (you can replace with your actual image paths) | |
| smiles_image_mapping = { | |
| "Mol 1": {"smiles": "C=C(C)CC(=O)NC[C@H](CO)NC(=O)C=Cc1ccc(C)c(Cl)c1", "image": "img/img1.png"}, | |
| # Example SMILES for ethanol | |
| "Mol 2": {"smiles": "C=CC1(CC(=O)NC[C@@H](CCCC)NC(=O)c2cc(Cl)cc(Br)c2)CC1", "image": "img/img2.png"}, | |
| # Example SMILES for butane | |
| "Mol 3": {"smiles": "C=C(C)C[C@H](NC(C)=O)C(=O)N1CC[C@H](NC(=O)[C@H]2C[C@@]2(C)Br)C(C)(C)C1", | |
| "image": "img/img3.png"}, # Example SMILES for ethylamine | |
| "Mol 4": {"smiles": "C=C1CC(CC(=O)N[C@H]2CCN(C(=O)c3ncccc3SC)C23CC3)C1", "image": "img/img4.png"}, | |
| # Example SMILES for diethyl ether | |
| "Mol 5": {"smiles": "C=CCS[C@@H](C)CC(=O)OCC", "image": "img/img5.png"} # Example SMILES for chloroethane | |
| } | |
| datasets = [" ", "BACE", "ESOL", "Load Custom Dataset"] | |
| models_enabled = ["SELFIES-TED", "MHG-GED", "MolFormer", "SMI-TED"] | |
| fusion_available = ["Concat"] | |
| global log_df | |
| log_df = pd.DataFrame(columns=["Selected Models", "Dataset", "Task", "Result"]) | |
| def log_selection(models, dataset, task_type, result, log_df): | |
| # Append the new entry to the DataFrame | |
| new_entry = {"Selected Models": str(models), "Dataset": dataset, "Task": task_type, "Result": result} | |
| updated_log_df = log_df.append(new_entry, ignore_index=True) | |
| return updated_log_df | |
| # Function to handle evaluation and logging | |
| def save_rep(models, dataset, task_type, eval_output): | |
| return | |
| def evaluate_and_log(models, dataset, task_type, eval_output): | |
| task_dic = {'Classification': 'CLS', 'Regression': 'RGR'} | |
| result = f"{eval_output}"#display_eval(models, dataset, task_type, fusion_type=None) | |
| result = result.replace(" Score", "") | |
| new_entry = {"Selected Models": str(models), "Dataset": dataset, "Task": task_dic[task_type], "Result": result} | |
| new_entry_df = pd.DataFrame([new_entry]) | |
| log_df = pd.read_csv('log.csv', index_col=0) | |
| log_df = pd.concat([new_entry_df, log_df]) | |
| log_df.to_csv('log.csv') | |
| return log_df | |
| try: | |
| log_df = pd.read_csv('log.csv', index_col=0) | |
| except: | |
| log_df = pd.DataFrame({"":[], | |
| 'Selected Models': [], | |
| 'Dataset': [], | |
| 'Task': [], | |
| 'Result': [] | |
| }) | |
| csv_file_path = 'log.csv' | |
| log_df.to_csv(csv_file_path, index=False) | |
| # Load images for selection | |
| def load_image(path): | |
| try: | |
| return Image.open(smiles_image_mapping[path]["image"])# Image.1open(path) | |
| except: | |
| pass | |
| # Function to handle image selection | |
| def handle_image_selection(image_key): | |
| smiles = smiles_image_mapping[image_key]["smiles"] | |
| mol_image = smiles_to_image(smiles) | |
| return smiles, mol_image | |
| def calculate_properties(smiles): | |
| mol = Chem.MolFromSmiles(smiles) | |
| if mol: | |
| qed = QED.qed(mol) | |
| logp = MolLogP(mol) | |
| sa = sascorer.calculateScore(mol) | |
| wt = Descriptors.MolWt(mol) | |
| return qed, sa, logp, wt | |
| return None, None, None, None | |
| # Function to calculate Tanimoto similarity | |
| def calculate_tanimoto(smiles1, smiles2): | |
| mol1 = Chem.MolFromSmiles(smiles1) | |
| mol2 = Chem.MolFromSmiles(smiles2) | |
| if mol1 and mol2: | |
| # fp1 = FingerprintMols.FingerprintMol(mol1) | |
| # fp2 = FingerprintMols.FingerprintMol(mol2) | |
| fp1 = AllChem.GetMorganFingerprintAsBitVect(mol1, 2) | |
| fp2 = AllChem.GetMorganFingerprintAsBitVect(mol2, 2) | |
| return round(DataStructs.FingerprintSimilarity(fp1, fp2), 2) | |
| return None | |
| #with open("models/selfies_model/bart-2908.pickle", "rb") as input_file: | |
| # gen_model, gen_tokenizer = pickle.load(input_file) | |
| gen_tokenizer = AutoTokenizer.from_pretrained("ibm/materials.selfies-ted") | |
| gen_model = BartForConditionalGeneration.from_pretrained("ibm/materials.selfies-ted") | |
| def generate(latent_vector, mask): | |
| encoder_outputs = BaseModelOutput(latent_vector) | |
| decoder_output = gen_model.generate(encoder_outputs=encoder_outputs, attention_mask=mask, | |
| max_new_tokens=64, do_sample=True, top_k=5, top_p=0.95, num_return_sequences=1) | |
| selfies = gen_tokenizer.batch_decode(decoder_output, skip_special_tokens=True) | |
| outs = [] | |
| for i in selfies: | |
| try: | |
| decoded = sf.decoder(i.replace("] [", "][")) | |
| outs.append(decoded) | |
| except selfies.exceptions.DecoderError: | |
| print(f"Error decoding SELFIES string: {i}") | |
| #outs.append(sf.decoder(i.replace("] [", "]["))) | |
| return outs | |
| def perturb_latent(latent_vecs, noise_scale=0.5): | |
| modified_vec = torch.tensor(np.random.uniform(0, 1, latent_vecs.shape) * noise_scale, | |
| dtype=torch.float32) + latent_vecs | |
| return modified_vec | |
| def encode(selfies): | |
| encoding = gen_tokenizer(selfies, return_tensors='pt', max_length=128, truncation=True, padding='max_length') | |
| input_ids = encoding['input_ids'] | |
| attention_mask = encoding['attention_mask'] | |
| outputs = gen_model.model.encoder(input_ids=input_ids, attention_mask=attention_mask) | |
| model_output = outputs.last_hidden_state | |
| """input_mask_expanded = attention_mask.unsqueeze(-1).expand(model_output.size()).float() | |
| sum_embeddings = torch.sum(model_output * input_mask_expanded, 1) | |
| sum_mask = torch.clamp(input_mask_expanded.sum(1), min=1e-9) | |
| model_output = sum_embeddings / sum_mask""" | |
| return model_output, attention_mask | |
| # Function to generate canonical SMILES and molecule image | |
| def generate_canonical(smiles): | |
| s = sf.encoder(smiles) | |
| selfie = s.replace("][", "] [") | |
| latent_vec, mask = encode([selfie]) | |
| gen_mol = None | |
| for i in range(5, 51): | |
| print("Searching Latent space") | |
| noise = i / 10 | |
| perturbed_latent = perturb_latent(latent_vec, noise_scale=noise) | |
| gen = generate(perturbed_latent, mask) | |
| gen_mol = Chem.MolToSmiles(Chem.MolFromSmiles(gen[0])) | |
| if gen_mol != Chem.MolToSmiles(Chem.MolFromSmiles(smiles)): break | |
| if gen_mol: | |
| # Calculate properties for ref and gen molecules | |
| print("calculating properties") | |
| ref_properties = calculate_properties(smiles) | |
| gen_properties = calculate_properties(gen_mol) | |
| tanimoto_similarity = calculate_tanimoto(smiles, gen_mol) | |
| # Prepare the table with ref mol and gen mol | |
| data = { | |
| "Property": ["QED", "SA", "LogP", "Mol Wt", "Tanimoto Similarity"], | |
| "Reference Mol": [ref_properties[0], ref_properties[1], ref_properties[2], ref_properties[3], | |
| tanimoto_similarity], | |
| "Generated Mol": [gen_properties[0], gen_properties[1], gen_properties[2], gen_properties[3], ""] | |
| } | |
| df = pd.DataFrame(data) | |
| # Display molecule image of canonical smiles | |
| print("Getting image") | |
| mol_image = smiles_to_image(gen_mol) | |
| return df, gen_mol, mol_image | |
| return "Invalid SMILES", None, None | |
| # Function to display evaluation score | |
| def display_eval(selected_models, dataset, task_type, downstream, fusion_type): | |
| result = None | |
| try: | |
| downstream_model = downstream.split("*")[0].lstrip() | |
| downstream_model = downstream_model.rstrip() | |
| hyp_param = downstream.split("*")[-1].lstrip() | |
| hyp_param = hyp_param.rstrip() | |
| hyp_param = hyp_param.replace("nan", "float('nan')") | |
| params = eval(hyp_param) | |
| except: | |
| downstream_model = downstream.split("*")[0].lstrip() | |
| downstream_model = downstream_model.rstrip() | |
| params = None | |
| try: | |
| if not selected_models: | |
| return "Please select at least one enabled model." | |
| if task_type == "Classification": | |
| global roc_auc, fpr, tpr, x_batch, y_batch | |
| elif task_type == "Regression": | |
| global RMSE, y_batch_test, y_prob | |
| if len(selected_models) > 1: | |
| if task_type == "Classification": | |
| #result, roc_auc, fpr, tpr, x_batch, y_batch = fm4m.multi_modal(model_list=selected_models, | |
| # downstream_model="XGBClassifier", | |
| # dataset=dataset.lower()) | |
| if downstream_model == "Default Settings": | |
| downstream_model = "DefaultClassifier" | |
| params = None | |
| result, roc_auc, fpr, tpr, x_batch, y_batch = fm4m.multi_modal(model_list=selected_models, | |
| downstream_model=downstream_model, | |
| params = params, | |
| dataset=dataset) | |
| elif task_type == "Regression": | |
| #result, RMSE, y_batch_test, y_prob = fm4m.multi_modal(model_list=selected_models, | |
| # downstream_model="XGBRegressor", | |
| # dataset=dataset.lower()) | |
| if downstream_model == "Default Settings": | |
| downstream_model = "DefaultRegressor" | |
| params = None | |
| result, RMSE, y_batch_test, y_prob, x_batch, y_batch = fm4m.multi_modal(model_list=selected_models, | |
| downstream_model=downstream_model, | |
| params=params, | |
| dataset=dataset) | |
| else: | |
| if task_type == "Classification": | |
| #result, roc_auc, fpr, tpr, x_batch, y_batch = fm4m.single_modal(model=selected_models[0], | |
| # downstream_model="XGBClassifier", | |
| # dataset=dataset.lower()) | |
| if downstream_model == "Default Settings": | |
| downstream_model = "DefaultClassifier" | |
| params = None | |
| result, roc_auc, fpr, tpr, x_batch, y_batch = fm4m.single_modal(model=selected_models[0], | |
| downstream_model=downstream_model, | |
| params=params, | |
| dataset=dataset) | |
| elif task_type == "Regression": | |
| #result, RMSE, y_batch_test, y_prob = fm4m.single_modal(model=selected_models[0], | |
| # downstream_model="XGBRegressor", | |
| # dataset=dataset.lower()) | |
| if downstream_model == "Default Settings": | |
| downstream_model = "DefaultRegressor" | |
| params = None | |
| result, RMSE, y_batch_test, y_prob, x_batch, y_batch = fm4m.single_modal(model=selected_models[0], | |
| downstream_model=downstream_model, | |
| params=params, | |
| dataset=dataset) | |
| if result == None: | |
| result = "Data & Model Setting is incorrect" | |
| except Exception as e: | |
| return f"An error occurred: {e}" | |
| return f"{result}" | |
| # Function to handle plot display | |
| def display_plot(plot_type): | |
| fig, ax = plt.subplots() | |
| if plot_type == "Latent Space": | |
| global x_batch, y_batch | |
| ax.set_title("T-SNE Plot") | |
| # reducer = umap.UMAP(metric='euclidean', n_neighbors= 10, n_components=2, low_memory=True, min_dist=0.1, verbose=False) | |
| # features_umap = reducer.fit_transform(x_batch[:500]) | |
| # x = y_batch.values[:500] | |
| # index_0 = [index for index in range(len(x)) if x[index] == 0] | |
| # index_1 = [index for index in range(len(x)) if x[index] == 1] | |
| class_0 = x_batch # features_umap[index_0] | |
| class_1 = y_batch # features_umap[index_1] | |
| """with open("latent_multi_bace.pkl", "rb") as f: | |
| class_0, class_1 = pickle.load(f) | |
| """ | |
| plt.scatter(class_1[:, 0], class_1[:, 1], c='red', label='Class 1') | |
| plt.scatter(class_0[:, 0], class_0[:, 1], c='blue', label='Class 0') | |
| ax.set_xlabel('Feature 1') | |
| ax.set_ylabel('Feature 2') | |
| ax.set_title('Dataset Distribution') | |
| elif plot_type == "ROC-AUC": | |
| global roc_auc, fpr, tpr | |
| ax.set_title("ROC-AUC Curve") | |
| try: | |
| ax.plot(fpr, tpr, color='darkorange', lw=2, label=f'ROC curve (area = {roc_auc:.4f})') | |
| ax.plot([0, 1], [0, 1], color='navy', lw=2, linestyle='--') | |
| ax.set_xlim([0.0, 1.0]) | |
| ax.set_ylim([0.0, 1.05]) | |
| except: | |
| pass | |
| ax.set_xlabel('False Positive Rate') | |
| ax.set_ylabel('True Positive Rate') | |
| ax.set_title('Receiver Operating Characteristic') | |
| ax.legend(loc='lower right') | |
| elif plot_type == "Parity Plot": | |
| global RMSE, y_batch_test, y_prob | |
| ax.set_title("Parity plot") | |
| # change format | |
| try: | |
| print(y_batch_test) | |
| print(y_prob) | |
| y_batch_test = np.array(y_batch_test, dtype=float) | |
| y_prob = np.array(y_prob, dtype=float) | |
| ax.scatter(y_batch_test, y_prob, color="blue", label=f"Predicted vs Actual (RMSE: {RMSE:.4f})") | |
| min_val = min(min(y_batch_test), min(y_prob)) | |
| max_val = max(max(y_batch_test), max(y_prob)) | |
| ax.plot([min_val, max_val], [min_val, max_val], 'r-') | |
| except: | |
| y_batch_test = [] | |
| y_prob = [] | |
| RMSE = None | |
| print(y_batch_test) | |
| print(y_prob) | |
| ax.set_xlabel('Actual Values') | |
| ax.set_ylabel('Predicted Values') | |
| ax.legend(loc='lower right') | |
| return fig | |
| # Predefined dataset paths (these should be adjusted to your file paths) | |
| predefined_datasets = { | |
| " ": " ", | |
| "BACE": f"./data/bace/train.csv, ./data/bace/test.csv, smiles, Class", | |
| "ESOL": f"./data/esol/train.csv, ./data/esol/test.csv, smiles, prop", | |
| } | |
| # Function to load a predefined dataset from the local path | |
| def load_predefined_dataset(dataset_name): | |
| val = predefined_datasets.get(dataset_name) | |
| try: file_path = val.split(",")[0] | |
| except:file_path=False | |
| if file_path: | |
| df = pd.read_csv(file_path) | |
| return df.head(), gr.update(choices=list(df.columns)), gr.update(choices=list(df.columns)), f"{dataset_name.lower()}" | |
| return pd.DataFrame(), gr.update(choices=[]), gr.update(choices=[]), f"Dataset not found" | |
| # Function to display the head of the uploaded CSV file | |
| def display_csv_head(file): | |
| if file is not None: | |
| # Load the CSV file into a DataFrame | |
| df = pd.read_csv(file.name) | |
| return df.head(), gr.update(choices=list(df.columns)), gr.update(choices=list(df.columns)) | |
| return pd.DataFrame(), gr.update(choices=[]), gr.update(choices=[]) | |
| # Function to handle dataset selection (predefined or custom) | |
| def handle_dataset_selection(selected_dataset): | |
| if selected_dataset == "Custom Dataset": | |
| # Show file upload fields for train and test datasets if "Custom Dataset" is selected | |
| return gr.update(visible=True), gr.update(visible=True), gr.update(visible=True), gr.update(visible=True), gr.update( | |
| visible=True), gr.update(visible=False), gr.update(visible=True), gr.update(visible=True) | |
| else: | |
| return gr.update(visible=True), gr.update(visible=False), gr.update(visible=False), gr.update( | |
| visible=False), gr.update(visible=False), gr.update(visible=False), gr.update(visible=False), gr.update(visible=False) | |
| # Function to select input and output columns and display a message | |
| def select_columns(input_column, output_column, train_data, test_data,dataset_name): | |
| if input_column and output_column: | |
| return f"{train_data.name},{test_data.name},{input_column},{output_column},{dataset_name}" | |
| return "Please select both input and output columns." | |
| def set_dataname(dataset_name, dataset_selector ): | |
| if dataset_selector == "Custom Dataset": | |
| return f"{dataset_name}" | |
| return f"{dataset_selector}" | |
| # Function to create model based on user input | |
| def create_model(model_name, max_depth=None, n_estimators=None, alpha=None, degree=None, kernel=None): | |
| if model_name == "XGBClassifier": | |
| model = xgb.XGBClassifier(objective='binary:logistic',eval_metric= 'auc', max_depth=max_depth, n_estimators=n_estimators, alpha=alpha) | |
| elif model_name == "SVR": | |
| model = SVR(degree=degree, kernel=kernel) | |
| elif model_name == "Kernel Ridge": | |
| model = KernelRidge(alpha=alpha, degree=degree, kernel=kernel) | |
| elif model_name == "Linear Regression": | |
| model = LinearRegression() | |
| elif model_name == "Default - Auto": | |
| model = "Default Settings" | |
| return f"{model}" | |
| else: | |
| return "Model not supported." | |
| return f"{model_name} * {model.get_params()}" | |
| def model_selector(model_name): | |
| # Dynamically return the appropriate hyperparameter components based on the selected model | |
| if model_name == "XGBClassifier": | |
| return ( | |
| gr.Slider(1, 10, label="max_depth"), | |
| gr.Slider(50, 500, label="n_estimators"), | |
| gr.Slider(0.1, 10.0, step=0.1, label="alpha") | |
| ) | |
| elif model_name == "SVR": | |
| return ( | |
| gr.Slider(1, 5, label="degree"), | |
| gr.Dropdown(["rbf", "poly", "linear"], label="kernel") | |
| ) | |
| elif model_name == "Kernel Ridge": | |
| return ( | |
| gr.Slider(0.1, 10.0, step=0.1, label="alpha"), | |
| gr.Slider(1, 5, label="degree"), | |
| gr.Dropdown(["rbf", "poly", "linear"], label="kernel") | |
| ) | |
| elif model_name == "Linear Regression": | |
| return () # No hyperparameters for Linear Regression | |
| else: | |
| return () | |
| # Define the Gradio layout | |
| # with gr.Blocks(theme=my_theme) as demo: | |
| with gr.Blocks() as demo: | |
| with gr.Row(): | |
| # Left Column | |
| with gr.Column(): | |
| gr.HTML(''' | |
| <div style="background-color: #6A8EAE; color: #FFFFFF; padding: 10px;"> | |
| <h3 style="color: #FFFFFF; margin: 0;font-size: 20px;"> Data & Model Setting</h3> | |
| </div> | |
| ''') | |
| # gr.Markdown("## Data & Model Setting") | |
| #dataset_dropdown = gr.Dropdown(choices=datasets, label="Select Dat") | |
| # Dropdown menu for predefined datasets including "Custom Dataset" option | |
| dataset_selector = gr.Dropdown(label="Select Dataset", | |
| choices=list(predefined_datasets.keys()) + ["Custom Dataset"]) | |
| # Display the message for selected columns | |
| selected_columns_message = gr.Textbox(label="Selected Columns Info", visible=False) | |
| with gr.Accordion("Dataset Settings", open=True): | |
| # File upload options for custom dataset (train and test) | |
| dataset_name = gr.Textbox(label="Dataset Name", visible=False) | |
| train_file = gr.File(label="Upload Custom Train Dataset", file_types=[".csv"], visible=False) | |
| train_display = gr.Dataframe(label="Train Dataset Preview (First 5 Rows)", visible=False, interactive=False) | |
| test_file = gr.File(label="Upload Custom Test Dataset", file_types=[".csv"], visible=False) | |
| test_display = gr.Dataframe(label="Test Dataset Preview (First 5 Rows)", visible=False, interactive=False) | |
| # Predefined dataset displays | |
| predefined_display = gr.Dataframe(label="Predefined Dataset Preview (First 5 Rows)", visible=False, | |
| interactive=False) | |
| # Dropdowns for selecting input and output columns for the custom dataset | |
| input_column_selector = gr.Dropdown(label="Select Input Column", choices=[], visible=False) | |
| output_column_selector = gr.Dropdown(label="Select Output Column", choices=[], visible=False) | |
| #selected_columns_message = gr.Textbox(label="Selected Columns Info", visible=True) | |
| # When a dataset is selected, show either file upload fields (for custom) or load predefined datasets | |
| dataset_selector.change(handle_dataset_selection, | |
| inputs=dataset_selector, | |
| outputs=[dataset_name, train_file, train_display, test_file, test_display, predefined_display, | |
| input_column_selector, output_column_selector]) | |
| # When a predefined dataset is selected, load its head and update column selectors | |
| dataset_selector.change(load_predefined_dataset, | |
| inputs=dataset_selector, | |
| outputs=[predefined_display, input_column_selector, output_column_selector, selected_columns_message]) | |
| # When a custom train file is uploaded, display its head and update column selectors | |
| train_file.change(display_csv_head, inputs=train_file, | |
| outputs=[train_display, input_column_selector, output_column_selector]) | |
| # When a custom test file is uploaded, display its head | |
| test_file.change(display_csv_head, inputs=test_file, | |
| outputs=[test_display, input_column_selector, output_column_selector]) | |
| dataset_selector.change(set_dataname, | |
| inputs=[dataset_name, dataset_selector], | |
| outputs=dataset_name) | |
| # Update the selected columns information when dropdown values are changed | |
| input_column_selector.change(select_columns, | |
| inputs=[input_column_selector, output_column_selector, train_file, test_file, dataset_name], | |
| outputs=selected_columns_message) | |
| output_column_selector.change(select_columns, | |
| inputs=[input_column_selector, output_column_selector, train_file, test_file, dataset_name], | |
| outputs=selected_columns_message) | |
| model_checkbox = gr.CheckboxGroup(choices=models_enabled, label="Select Model") | |
| # Add disabled checkboxes for GNN and FNN | |
| # gnn_checkbox = gr.Checkbox(label="GNN (Disabled)", value=False, interactive=False) | |
| # fnn_checkbox = gr.Checkbox(label="FNN (Disabled)", value=False, interactive=False) | |
| task_radiobutton = gr.Radio(choices=["Classification", "Regression"], label="Task Type") | |
| ####### adding hyper parameter tuning ########### | |
| model_name = gr.Dropdown(["Default - Auto", "XGBClassifier", "SVR", "Kernel Ridge", "Linear Regression"], label="Select Downstream Model") | |
| with gr.Accordion("Downstream Hyperparameter Settings", open=True): | |
| # Create placeholders for hyperparameter components | |
| max_depth = gr.Slider(1, 20, step=1,visible=False, label="max_depth") | |
| n_estimators = gr.Slider(100, 5000, step=100, visible=False, label="n_estimators") | |
| alpha = gr.Slider(0.1, 10.0, step=0.1, visible=False, label="alpha") | |
| degree = gr.Slider(1, 20, step=1,visible=False, label="degree") | |
| kernel = gr.Dropdown(choices=["rbf", "poly", "linear"], visible=False, label="kernel") | |
| # Output textbox | |
| output = gr.Textbox(label="Loaded Parameters") | |
| # Dynamically show relevant hyperparameters based on selected model | |
| def update_hyperparameters(model_name): | |
| if model_name == "XGBClassifier": | |
| return gr.update(visible=True), gr.update(visible=True), gr.update(visible=True), gr.update( | |
| visible=False), gr.update(visible=False) | |
| elif model_name == "SVR": | |
| return gr.update(visible=False), gr.update(visible=False), gr.update(visible=False), gr.update( | |
| visible=True), gr.update(visible=True) | |
| elif model_name == "Kernel Ridge": | |
| return gr.update(visible=False), gr.update(visible=False), gr.update(visible=True), gr.update( | |
| visible=True), gr.update(visible=True) | |
| elif model_name == "Linear Regression": | |
| return gr.update(visible=False), gr.update(visible=False), gr.update(visible=False), gr.update( | |
| visible=False), gr.update(visible=False) | |
| elif model_name == "Default - Auto": | |
| return gr.update(visible=False), gr.update(visible=False), gr.update(visible=False), gr.update( | |
| visible=False), gr.update(visible=False) | |
| # When model is selected, update which hyperparameters are visible | |
| model_name.change(update_hyperparameters, inputs=[model_name], | |
| outputs=[max_depth, n_estimators, alpha, degree, kernel]) | |
| # Submit button to create the model with selected hyperparameters | |
| submit_button = gr.Button("Create Downstream Model") | |
| # Function to handle model creation based on input parameters | |
| def on_submit(model_name, max_depth, n_estimators, alpha, degree, kernel): | |
| if model_name == "XGBClassifier": | |
| return create_model(model_name, max_depth=max_depth, n_estimators=n_estimators, alpha=alpha) | |
| elif model_name == "SVR": | |
| return create_model(model_name, degree=degree, kernel=kernel) | |
| elif model_name == "Kernel Ridge": | |
| return create_model(model_name, alpha=alpha, degree=degree, kernel=kernel) | |
| elif model_name == "Linear Regression": | |
| return create_model(model_name) | |
| elif model_name == "Default - Auto": | |
| return create_model(model_name) | |
| # When the submit button is clicked, run the on_submit function | |
| submit_button.click(on_submit, inputs=[model_name, max_depth, n_estimators, alpha, degree, kernel], | |
| outputs=output) | |
| ###### End of hyper param tuning ######### | |
| fusion_radiobutton = gr.Radio(choices=fusion_available, label="Fusion Type") | |
| eval_button = gr.Button("Train downstream model") | |
| #eval_button.style(css_class="custom-button-left") | |
| # Middle Column | |
| with gr.Column(): | |
| gr.HTML(''' | |
| <div style="background-color: #8F9779; color: #FFFFFF; padding: 10px;"> | |
| <h3 style="color: #FFFFFF; margin: 0;font-size: 20px;"> Downstream Task 1: Property Prediction</h3> | |
| </div> | |
| ''') | |
| # gr.Markdown("## Downstream task Result") | |
| eval_output = gr.Textbox(label="Train downstream model") | |
| plot_radio = gr.Radio(choices=["ROC-AUC", "Parity Plot", "Latent Space"], label="Select Plot Type") | |
| plot_output = gr.Plot(label="Visualization")#, height=250, width=250) | |
| #download_rep = gr.Button("Download representation") | |
| create_log = gr.Button("Store log") | |
| log_table = gr.Dataframe(value=log_df, label="Log of Selections and Results", interactive=False) | |
| eval_button.click(display_eval, | |
| inputs=[model_checkbox, selected_columns_message, task_radiobutton, output, fusion_radiobutton], | |
| outputs=eval_output) | |
| plot_radio.change(display_plot, inputs=plot_radio, outputs=plot_output) | |
| # Function to gather selected models | |
| def gather_selected_models(*models): | |
| selected = [model for model in models if model] | |
| return selected | |
| create_log.click(evaluate_and_log, inputs=[model_checkbox, dataset_name, task_radiobutton, eval_output], | |
| outputs=log_table) | |
| #download_rep.click(save_rep, inputs=[model_checkbox, dataset_name, task_radiobutton, eval_output], | |
| # outputs=None) | |
| # Right Column | |
| with gr.Column(): | |
| gr.HTML(''' | |
| <div style="background-color: #D2B48C; color: #FFFFFF; padding: 10px;"> | |
| <h3 style="color: #FFFFFF; margin: 0;font-size: 20px;"> Downstream Task 2: Molecule Generation</h3> | |
| </div> | |
| ''') | |
| # gr.Markdown("## Molecular Generation") | |
| smiles_input = gr.Textbox(label="Input SMILES String") | |
| image_display = gr.Image(label="Molecule Image", height=250, width=250) | |
| # Show images for selection | |
| with gr.Accordion("Select from sample molecules", open=False): | |
| image_selector = gr.Radio( | |
| choices=list(smiles_image_mapping.keys()), | |
| label="Select from sample molecules", | |
| value=None, | |
| #item_images=[load_image(smiles_image_mapping[key]["image"]) for key in smiles_image_mapping.keys()] | |
| ) | |
| image_selector.change(load_image, image_selector, image_display) | |
| generate_button = gr.Button("Generate") | |
| gen_image_display = gr.Image(label="Generated Molecule Image", height=250, width=250) | |
| generated_output = gr.Textbox(label="Generated Output") | |
| property_table = gr.Dataframe(label="Molecular Properties Comparison") | |
| # Handle image selection | |
| image_selector.change(handle_image_selection, inputs=image_selector, outputs=[smiles_input, image_display]) | |
| smiles_input.change(smiles_to_image, inputs=smiles_input, outputs=image_display) | |
| # Generate button to display canonical SMILES and molecule image | |
| generate_button.click(generate_canonical, inputs=smiles_input, | |
| outputs=[property_table, generated_output, gen_image_display]) | |
| if __name__ == "__main__": | |
| demo.launch(share=True) | |